Introduction：Basic information about 5-Hydroxy-3-tert-butyl-salicylaldehyde CAS 192803-37-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
5-Hydroxy-3-tert-butyl-salicylaldehyde Basic information
| Product Name: | 5-Hydroxy-3-tert-butyl-salicylaldehyde |
| Synonyms: | 5-Hydroxy-3-tert-butyl-salicylaldehyde;3-Tert-Butyl-2,5-dihydroxybenzaldehyde;Benzaldehyde, 3-(1,1-dimethylethyl)-2,5-dihydroxy-;3-(1,1-Dimethylethyl)-2,5-dihydroxybenzaldehyde |
| CAS: | 192803-37-5 |
| MF: | C11H14O3 |
| MW: | 194.23 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 192803-37-5.mol |
|
5-Hydroxy-3-tert-butyl-salicylaldehyde Chemical Properties
| Melting point | 140-142 °C |
| Boiling point | 295.9±35.0 °C(Predicted) |
| density | 1.179±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | 10.10±0.23(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C11H14O3/c1-11(2,3)9-5-8(13)4-7(6-12)10(9)14/h4-6,13-14H,1-3H3 |
| InChIKey | TZZLDYZCZGLIJA-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(O)=CC(C(C)(C)C)=C1O |
Safety Information
5-Hydroxy-3-tert-butyl-salicylaldehyde Usage And Synthesis
| Description | 3-Tert-butyl-2,5-dihydroxybenzaldehyde (5-Hydroxy-3-tert-butyl-salicylaldehyde) is an epoxide that contains a hydroxyl group. It is used in the synthesis of chiral epoxides and sulfoxides. This compound reacts with thionyl chloride to produce sulfoxide compounds. The reaction between 3-tent-butyl-2,5-dihydroxybenzaldehyde and hydrogen peroxide produces a chiral epoxide, which can be oxidized to form an aldehyde or reduced to a ketone. This chemical has been shown to react with chloride ions in the presence of an oxidant such as potassium permanganate or peroxy trifluoroacetic acid, forming chlorinated derivatives. |
5-Hydroxy-3-tert-butyl-salicylaldehyde Preparation Products And Raw materials
