Introduction：Basic information about 5-Hydroxy-6,7-dimethoxycoumarin CAS 28449-62-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
5-Hydroxy-6,7-dimethoxycoumarin Basic information
| Product Name: | 5-Hydroxy-6,7-dimethoxycoumarin |
| Synonyms: | 5-Hydroxy-6,7-dimethoxy-2H-1-benzopyran-2-one;5-Hydroxy-6,7-dimethoxycoumarin;Tomentin【coumarin】;2H-1-Benzopyran-2-one, 5-hydroxy-6,7-dimethoxy- |
| CAS: | 28449-62-9 |
| MF: | C11H10O5 |
| MW: | 222.19 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 28449-62-9.mol |
|
5-Hydroxy-6,7-dimethoxycoumarin Chemical Properties
| Melting point | 185-186 °C |
| Boiling point | 421.9±45.0 °C(Predicted) |
| density | 1.358±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 7.00±0.20(Predicted) |
| InChI | 1S/C11H10O5/c1-14-8-5-7-6(3-4-9(12)16-7)10(13)11(8)15-2/h3-5,13H,1-2H3 |
| InChIKey | KCPNDUHAXDHRKX-UHFFFAOYSA-N |
| SMILES | O=C1C=CC2=C(O)C(OC)=C(OC)C=C2O1 |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
5-Hydroxy-6,7-dimethoxycoumarin Usage And Synthesis
| Uses | Tomentin is a compound isolated from Sphaeralcea angustifolia. Tomentin inhibits the formation of λ-carrageenan footpad edema at 58 %. Tomentin inhibits the phorbol ester-induced auricular edema formation by 57 %[1]. |
| References | [1] Pérez-Hernández J, et al. Sphaeralcic acid and tomentin, anti-inflammatory compounds produced in cell suspension cultures of Sphaeralcea angustifolia. Planta Med. 2014;80(2-3):209-214. DOI:10.1055/s-0033-1360302 |
5-Hydroxy-6,7-dimethoxycoumarin Preparation Products And Raw materials
