Introduction：Basic information about 7-Methoxy-1-naphthylacetonitrile CAS 138113-08-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
7-Methoxy-1-naphthylacetonitrile Basic information
| Product Name: | 7-Methoxy-1-naphthylacetonitrile |
| Synonyms: | 1-Cyanomethyl-7-methoxynaphthalene;2-(7-Methoxy-1-naphthyl)acetonitrile;7-Methoxy-1-naphthaleneacetinitrile;2-(7-methoxynaphthalen-1-yl)acetonitrile;Agomelatine Intermediate 1;7-Methoxy-1-naphthylacetonitrile;N-[2-(7-Methoxy-1-naphthyl)ethyl]acetaMide;AgoMelatine interMediate A |
| CAS: | 138113-08-3 |
| MF: | C13H11NO |
| MW: | 197.23 |
| EINECS: | 461-670-1 |
| Product Categories: | Intermediate of Agomelatine;Aromatics Compounds;Aromatics |
| Mol File: | 138113-08-3.mol |
|
7-Methoxy-1-naphthylacetonitrile Chemical Properties
| Melting point | 81-83°C |
| Boiling point | 374.3±17.0 °C(Predicted) |
| density | 1.135±0.06 g/cm3(Predicted) |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | 1.44 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | slightly sol. in Methanol |
| form | Powder |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C13H11NO/c1-15-12-6-5-10-3-2-4-11(7-8-14)13(10)9-12/h2-6,9H,7H2,1H3 |
| InChIKey | PYJMGUQHJINLLD-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=C2C(C=CC(OC)=C2)=CC=C1 |
| LogP | 2.79 at 26℃ and pH7 |
| Surface tension | 73.1mN/m at 12.33mg/L and 20℃ |
| CAS DataBase Reference | 138113-08-3 |
Safety Information
| RIDADR | UN 3439 6.1/PG III |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
7-Methoxy-1-naphthylacetonitrile Usage And Synthesis
| Chemical Properties | Tan Solid |
7-Methoxy-1-naphthylacetonitrile Preparation Products And Raw materials
