Introduction:Basic information about alpha-Bromo-2-chlorophenylacetic acid CAS 141109-25-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
alpha-Bromo-2-chlorophenylacetic acid Basic information
| Product Name: | alpha-Bromo-2-chlorophenylacetic acid |
| Synonyms: | ALPHA-BROMO-2-CHLOROPHENYLACETIC ACID;A-BROMO 2-CHLOROPHENYLACETIC ACID;2-Bromo-2?Chlorophenylacetic Acid;-Bromo-2-Chlorophenylacetic Acid;alpha-2-(Chlorophenyl)acetic acid;α-Bromo-O-Chlorophenylacetic Acid;Alapha-bromo-(2-chloro)-phenylacetic acid;α-Bromo-2-(2-chlorophenyl)acetic acid |
| CAS: | 141109-25-3 |
| MF: | C8H6BrClO2 |
| MW: | 249.49 |
| EINECS: | 604-221-9 |
| Product Categories: | Aromatic Phenylacetic Acids and Derivatives;INTERMEDIATESOFCLOPIDOGREL |
| Mol File: | 141109-25-3.mol |
|
alpha-Bromo-2-chlorophenylacetic acid Chemical Properties
| Melting point | 108-110°C |
| InChI | InChI=1S/C8H6BrClO2/c9-7(8(11)12)5-3-1-2-4-6(5)10/h1-4,7H,(H,11,12) |
| InChIKey | XHAPROULWZYBGA-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1Cl)C(Br)C(=O)O |
| CAS DataBase Reference | 141109-25-3(CAS DataBase Reference) |
Safety Information
alpha-Bromo-2-chlorophenylacetic acid Usage And Synthesis
alpha-Bromo-2-chlorophenylacetic acid Preparation Products And Raw materials