Introduction:Basic information about Bis(3,5-difluorophenyl)sulfoxide CAS 2055858-27-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Bis(3,5-difluorophenyl)sulfoxide Basic information
| Product Name: | Bis(3,5-difluorophenyl)sulfoxide |
| Synonyms: | 1,1′-Sulfinylbis[3,5-difluorobenzene;Bis(3,5-difluorophenyl)sulfoxide;Benzene, 1,1'-sulfinylbis[3,5-difluoro-;5,5'-Sulfinylbis(1,3-difluorobenzene);1,1'-Sulfinylbis[3,5-difluorobenzene |
| CAS: | 2055858-27-8 |
| MF: | C12H6F4OS |
| MW: | 274.23 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2055858-27-8.mol |
|
Bis(3,5-difluorophenyl)sulfoxide Chemical Properties
| Boiling point | 360.6±42.0 °C(Predicted) |
| density | 1.52±0.1 g/cm3(Predicted) |
| InChI | InChI=1S/C12H6F4OS/c13-7-1-8(14)4-11(3-7)18(17)12-5-9(15)2-10(16)6-12/h1-6H |
| InChIKey | VTZWUMHFBYQZRF-UHFFFAOYSA-N |
| SMILES | S(C1=CC(F)=CC(F)=C1)(C1=CC(F)=CC(F)=C1)=O |
Safety Information
Bis(3,5-difluorophenyl)sulfoxide Usage And Synthesis
| Uses | 1,1'-Sulfinylbis[3,5-difluorobenzene], also known as Bis(3,5-difluorophenyl)sulfoxide, is an organofluorinated reagent that can be used in the formation of positive photoresist compositions and patterns. |
Bis(3,5-difluorophenyl)sulfoxide Preparation Products And Raw materials