Introduction：Basic information about Bis(diphenylphosphino)methane CAS 2071-20-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Bis(diphenylphosphino)methane Basic information
| Product Name: | Bis(diphenylphosphino)methane |
| Synonyms: | METHYLENEBIS(DIPHENYLPHOSPHINE);AURORA KA-1146;BIS(DIPHENYLPHOSPHINE)METHANE;BIS(DIPHENYLPHOSPHINO)METHANE;DPM;[(1,1-DIPHENYLPHOSPHINO)METHYL](DIPHENYL)PHOSPHINE;Bis(diphenylphosphino)methane,97%;dppm |
| CAS: | 2071-20-7 |
| MF: | C25H22P2 |
| MW: | 384.39 |
| EINECS: | 218-194-2 |
| Product Categories: | organophosphine ligand;Achiral Phosphine;Aryl Phosphine;Ligand;Phosphines;Phosphine Ligands;Synthetic Organic Chemistry |
| Mol File: | 2071-20-7.mol |
|
Bis(diphenylphosphino)methane Chemical Properties
| Melting point | 118-119 °C(lit.) |
| Boiling point | 497.2±28.0 °C(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Fine Crystalline Powder |
| color | Almost white |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 758760 |
| InChI | InChI=1S/C25H22P2/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20H,21H2 |
| InChIKey | XGCDBGRZEKYHNV-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1)P(CP(C1C=CC=CC=1)C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 2071-20-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | No |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
Bis(diphenylphosphino)methane Usage And Synthesis
| Chemical Properties | white to light yellow crystal powde |
| Uses | suzuki reaction |
| Uses | It is applied as an organic synthesis catalyst. It is also used as an intermediate in flavor and fragrances. |
| reaction suitability | reagent type: ligand
reaction type: Heck Reaction
reagent type: ligand
reaction type: Suzuki-Miyaura Coupling |
Bis(diphenylphosphino)methane Preparation Products And Raw materials
| Raw materials | Ethanol-->Sodium hydroxide-->Hydrochloric acid-->Ethyl acetate-->Tetrahydrofuran-->Dichloromethane-->PETROLEUM ETHER-->Triphenylphosphine-->Lithium-->1,2-Bis(diphenylphosphino)ethane-->Diphenylphosphine-->Diphosphine, tetraphenyl-, 1-oxide |
