Chloramine B CAS 127-52-6
Introduction：Basic information about Chloramine B CAS 127-52-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Chloramine B Basic information
| Product Name: | Chloramine B |
| Synonyms: | Sodium (phenylsulfonyl)chloramide;Sodium benzenesulfochloramide;Chlordetal;Benzenesulfonamide, N-chloro-, sodium salt;Benzenesulfo-sodium chloramide;ChloraMine B BenzenesulfonaMide,N-chloro-, sodiuM salt (1:1);N-Chlorobenzenesulfonamide sodium salt ~28% active chlorine basis |
| CAS: | 127-52-6 |
| MF: | C6H5ClNNaO2S |
| MW: | 213.62 |
| EINECS: | 204-847-9 |
| Product Categories: | Synthetic Organic Chemistry;Typical Metal Compounds;fine chemical;Chlorination;Classes of Metal Compounds;Halogenation;Na (Sodium) Compounds (excluding simple sodium salts);127-52-6 |
| Mol File: | 127-52-6.mol |
Chloramine B Chemical Properties
| Melting point | 190°C |
| Boiling point | 189℃[at 101 325 Pa] |
| density | 1.484[at 20℃] |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | H2O: 0.1 g/mL, clear |
| form | solid |
| pka | 1.88[at 20 ℃] |
| Appearance | White to off-white Solid |
| Water Solubility | 0.1 g/mL |
| Merck | 14,2074 |
| BRN | 3599287 |
| InChI | InChI=1S/C6H5ClNO2S.Na/c7-8-11(9,10)6-4-2-1-3-5-6;/h1-5H;/q-1;+1 |
| InChIKey | KDNCILYKSYKEFJ-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)S(=O)(=O)N(Cl)[Na] |
| LogP | 0.14 at 26℃ |
| EPA Substance Registry System | Chloramine B (127-52-6) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 22-31-34-42-2 |
| Safety Statements | 7-22-26-36/37/39-45 |
| RIDADR | UN 3263 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DA9300000 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29350090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Resp. Sens. 1 Skin Corr. 1B |
| Hazardous Substances Data | 127-52-6(Hazardous Substances Data) |
| Uses | Used in investigations of the toxicity response of electroactive microbial biofilms Catalyst for rearrangement of aziridinofullerenes to azafulleroids Oxidizing agent for polymerization of thiophenol, synthesis of o-aminobenzenesulfonic acids and ciproflaxin Decontaminant for mustard |
| Uses | Chloramine B's a organochlorine disinfectant, and the effective chloric arrive 26-28%, the property is stable, only loss 0.1% effective chloric after airtight kept 1 year . Slightly soluble in water, and Stimulating & corrosive is small, so the efficacy is slower than hypochlorous acid. Chloramine-B is mainly used for disinfecting container of drinking water, all kind of tableware, fruits and vegetables(5ppm), aquaculture water and enamel instruments(1%). It's also can be used for cleaning breast of cattle, milk cup, livestock urinary tract, festering,etc. |
| Flammability and Explosibility | Non flammable |
| reaction suitability | reagent type: oxidant |
Chloramine B Preparation Products And Raw materials
| Preparation Products | Benzenesulfonamide |
