Introduction：Basic information about Cholesteryl chloride CAS 910-31-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Cholesteryl chloride Basic information
| Product Name: | Cholesteryl chloride |
| Synonyms: | CHOLESTERYL CHLORIDE 98%;CHOLESTERYL CHLORIDE(REAGENT / STANDARD GRADE);Cholesterylchloride,98%;3-b-Chlorocholest-5-ene.;CHOLESTERYLBETA-CHLORIDE;CHOLESTERYLCHLORIDE(CHOLESTEROLCHLORIDE);Cholest-5-ene, 3-chloro-, (3b)-;Cholesteryl Chloride from Beef Fat |
| CAS: | 910-31-6 |
| MF: | C27H45Cl |
| MW: | 405.1 |
| EINECS: | 213-004-4 |
| Product Categories: | Steroids;Organics |
| Mol File: | 910-31-6.mol |
|
Cholesteryl chloride Chemical Properties
| Melting point | 94-96 °C (lit.) |
| alpha | -30 º (c=1, chloroform) |
| Boiling point | 488.29°C (rough estimate) |
| density | 0.9160 (rough estimate) |
| refractive index | 1.6281 (estimate) |
| storage temp. | Store below +30°C. |
| form | powder |
| Optical Rotation | [α]25/D 24°, c = 1 in chloroform |
| BRN | 2703655 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1/C27H45Cl/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/s3 |
| InChIKey | OTVRYZXVVMZHHW-DPAQBDIFSA-N |
| SMILES | [C@@]12([H])CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@H](Cl)CC3=CC[C@@]21[H] |&1:0,4,5,13,17,19,23,29,r| |
| LogP | 11.576 (est) |
| CAS DataBase Reference | 910-31-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Cholest-5-ene, 3beta-chloro(910-31-6) |
| EPA Substance Registry System | Cholest-5-ene, 3-chloro-, (3.beta.)- (910-31-6) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29035990 |
| Storage Class | 11 - Combustible Solids |
Cholesteryl chloride Usage And Synthesis
| Chemical Properties | white to off-white crystalline powder |
| Uses | Cholesteryl chloride is an organochloride derivative of Cholesterol (HY-N0322). Cholesteryl chloride can be used in some hair colors, make-ups, and some other cosmetic preparations[1]. |
| References | [1] Ishimaru C, et al. Cholesterol hemisuccinate: a selective inhibitor of family X DNA polymerases. Biochem Biophys Res Commun. 2007 Mar 9;354(2):619-25. DOI:10.1016/j.bbrc.2007.01.034 |
Cholesteryl chloride Preparation Products And Raw materials
| Raw materials | Methanesulfonic acid 3β-cholesteryl ester-->Cholesteryl benzoate-->Cholesterol-->Benzoyl chloride |
