Clothianidin CAS 210880-92-5
Introduction：Basic information about Clothianidin CAS 210880-92-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Clothianidin Basic information
| Product Name: | Clothianidin |
| Synonyms: | CLOTHIANIDIN;Guanidine, N-(2-chloro-5-thiazolyl)methyl-N-methyl-N-nitro-, C(E)-;clothianidine;3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-1-nitro-guanidine;CLOTHIANIDIN STANDARD;(E)-1-(2-Chloro-1,3-thiazol-5-ylmethyl)-3-methyl-2-nitroguanidine;(E)-1-(2-Chloro-5-thiazolylmethyl)-3-methyl-2-nitroguanidine;Ccris 9264 |
| CAS: | 210880-92-5 |
| MF: | C6H8ClN5O2S |
| MW: | 249.67 |
| EINECS: | 433-460-1 |
| Product Categories: | Agrochemical;210880-92-5 |
| Mol File: | 210880-92-5.mol |
Clothianidin Chemical Properties
| Melting point | 178.8 °C |
| Boiling point | 412.5±55.0 °C(Predicted) |
| density | 1.61 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | 0-6°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:1): 0.50 mg/ml |
| pka | 2.76±0.50(Predicted) |
| form | Solid |
| color | Off-white to light yellow |
| Water Solubility | 327 mg/L at 20 ºC |
| Major Application | agriculture environmental |
| InChI | 1S/C6H8ClN5O2S/c1-8-6(11-12(13)14)10-3-4-2-9-5(7)15-4/h2H,3H2,1H3,(H2,8,10,11) |
| InChIKey | PGOOBECODWQEAB-UHFFFAOYSA-N |
| SMILES | CN\C(NCc1cnc(Cl)s1)=N/[N+]([O-])=O |
| LogP | 0.7 at 25℃ |
| CAS DataBase Reference | 210880-92-5 |
| EPA Substance Registry System | Clothianidin (210880-92-5) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 46-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 1 |
| RTECS | ME9565000 |
| HS Code | 29341000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 210880-92-5(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >5000 orally; >2000 dermally; LC50 in rats (mg/l): >6.1 inhalation; LC50 in bobwhite quail, mallard duck (ppm): >5200, >5200 (dietary); LC50 (96 hr) in rainbow trout, bluegill (mg/l): >100, >120 (Ohkawara) |
| Uses | Insecticide. |
| Definition | ChEBI: (E)-clothianidin is a clothiadin that has E configuration at the C=N bond of the nitroguanidine moiety. It has a role as a neonicotinoid insectide. |
| Flammability and Explosibility | Not classified |
Clothianidin Preparation Products And Raw materials
