Introduction：Basic information about daphnoretin CAS 2034-69-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
daphnoretin Basic information
| Product Name: | daphnoretin |
| Synonyms: | Coumarin, 7-hydroxy-6-methoxy-3,7'-oxydi-;7-Hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran 7-yl)-oxy]-2H-1-benzopyran-2-one;Thymerol;Daphnoretin ,98%;Dephnoretin;2H-1-Benzopyran-2-one,7-hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran-7-yl)oxy]-;aphnoretin;7-hydroxy-6-methoxy-3-(2-oxochromen-7-yl)oxychromen-2-one |
| CAS: | 2034-69-7 |
| MF: | C19H12O7 |
| MW: | 352.29 |
| EINECS: | |
| Product Categories: | Coumarins |
| Mol File: | 2034-69-7.mol |
|
daphnoretin Chemical Properties
| Melting point | 245-246℃ |
| Boiling point | 639.6±55.0 °C(Predicted) |
| density | 1.501 |
| storage temp. | 2-8°C |
| solubility | DMSO:100.0(Max Conc. mg/mL);283.85(Max Conc. mM) |
| form | A crystalline solid |
| pka | 7.53±0.20(Predicted) |
| color | Off-white to light yellow |
| Major Application | food and beverages |
| InChI | 1S/C19H12O7/c1-23-16-6-11-7-17(19(22)26-15(11)9-13(16)20)24-12-4-2-10-3-5-18(21)25-14(10)8-12/h2-9,20H,1H3 |
| InChIKey | JRHMMVBOTXEHGJ-UHFFFAOYSA-N |
| SMILES | [o]1c2c(cc([c]1=O)Oc3cc4[o][c](ccc4cc3)=O)cc(c(c2)O)OC |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
daphnoretin Usage And Synthesis
| Chemical Properties | Yellow powder, soluble in methanol and ethanol, poorly soluble in chloroform, ether and acetone, derived from King Lao. |
| Uses | Daphnoretin is an active constituent of Wikstroemia indica C. A. Meys which possesses anti-cancer activity. Inhibitory effect on mitosis. |
| Definition | ChEBI: A member of the class of coumarins that is coumarin substituted by a hydroxy group at position 7, a methoxy group at position 6 and a (2-oxo-2H-chromen-7-yl)oxy group at position 3. |
daphnoretin Preparation Products And Raw materials
