Introduction：Basic information about Diacetonefructose CAS 20880-92-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diacetonefructose Basic information
| Product Name: | Diacetonefructose |
| Synonyms: | 1,2,4,5-DI-O-ISOPROPYLIDENE-BETA-D-FRUCTOPYRANOSE;1,2:4,5-DI-O-ISOPROPYLIDENE-BETA-D-FRUCTOPYRANOSE;2,3:4,5-BIS-O-(1,2 METHYLETHYLIDENE)-BETA-D-FRUCTOPYRANOSE;2,3:4,5-Di-O-isopropylidene-b-D-fructopyranose;2,3,4,5-DI-O-ISOPROPYLIDENE-BETA-D-FRUCTOPYRANOSE;2,3:4,5-DI-O-ISOPROPYLIDENE-BETA-D-FRUCTOPYRANOSE;2,3:4,5-DI-O-ISOPROPYLIDENE-BETA-D-FRUCTOSE;2,3:4,5-Bis-O-(1-Methylethylidene)-β-D-fructopyranose |
| CAS: | 20880-92-6 |
| MF: | C12H20O6 |
| MW: | 260.28 |
| EINECS: | 606-663-8 |
| Product Categories: | chiral;Carbohydrates & Derivatives;API |
| Mol File: | 20880-92-6.mol |
|
Diacetonefructose Chemical Properties
| Melting point | 94-95°C |
| Boiling point | 332.6±37.0 °C(Predicted) |
| density | 1.181±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Soluble in chloroform, ethyl acetate, methanol. |
| pka | 14.63±0.10(Predicted) |
| form | Powder |
| color | White |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1/C12H20O6/c1-10(2)15-7-5-14-12(6-13)9(8(7)16-10)17-11(3,4)18-12/h7-9,13H,5-6H2,1-4H3/t7-,8-,9+,12+/s3 |
| InChIKey | PSSHGMIAIUYOJF-APOZVJGGSA-N |
| SMILES | [C@]12(CO)OC(C)(C)O[C@H]1[C@@H]1OC(C)(C)O[C@@H]1CO2 |&1:0,8,9,15,r| |
| CAS DataBase Reference | 20880-92-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
Diacetonefructose Usage And Synthesis
| Chemical Properties | White Solid |
| Uses | 2,3:4,5-Di-O-isopropylidene-beta-D-fructopyranose is used as chiral auxiliaries in Michael and Aldol addition reactions. |
Diacetonefructose Preparation Products And Raw materials
| Raw materials | Diacetone-D-glucose-->1,2:4,5-DI-O-ISOPROPYLIDENE-BETA-D-FRUCTOPYRANOSE-->1,2:3,4-Di-O-isopropylidene-D-galactopyranose-->Raffinose-->Acetone-->D(-)-Fructose |
| Preparation Products | 1-O-Methyl-D-fructose-->β-2,3:4,5-Di-O-isopropylidene-D-arabino-hexosulo-2,6-pyranose-->(1-methylethylidene)- |
