Introduction：Basic information about Diclofensine CAS 67165-56-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diclofensine Basic information
| Product Name: | Diclofensine |
| Synonyms: | Diclofensine;4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-7-methoxy-2-methylisoquinoline;Ro8-4650;4-(3,4-Dichlorophenyl)-7-Methoxy-2-Methyl-1,2,3,4-tetrahydroisoquinoline;4-(3,4-dichlorophenyl)-7-Methoxy-2-Methyl-3,4-dihydro-1H-isoquinoline hydrochloride;RO 8-4650;RO-8-4650;Isoquinoline, 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-7-methoxy-2-methyl-;rac- 4-(3,4-dichlorophenyl)-7-methoxy-2-methyl-1,2,3,4-tetrahydroisoquinoline |
| CAS: | 67165-56-4 |
| MF: | C17H17Cl2NO |
| MW: | 322.23 |
| EINECS: | |
| Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;research chemical;67165-56-4 |
| Mol File: | 67165-56-4.mol |
|
Diclofensine Chemical Properties
| Boiling point | 422.6±45.0 °C(Predicted) |
| density | 1.242 |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| pka | 7.87±0.40(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| InChI | InChI=1S/C17H17Cl2NO/c1-20-9-12-7-13(21-2)4-5-14(12)15(10-20)11-3-6-16(18)17(19)8-11/h3-8,15H,9-10H2,1-2H3 |
| InChIKey | ZJDCGVDEEHWEIG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(OC)=C2)C(C2=CC=C(Cl)C(Cl)=C2)CN1C |
Safety Information
Diclofensine Usage And Synthesis
| Uses | A stimulant; inhibits reuptake of dopamine and noradrenaline, is an effective antidepressant. Compound exhibits significant addictive properties. |
Diclofensine Preparation Products And Raw materials
