Introduction：Basic information about Huperzine B CAS 103548-82-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Huperzine B Basic information
| Product Name: | Huperzine B |
| Synonyms: | HuperzineB;12-Methyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8(7H)-one;8,15-Didehydrolycodin-1(18H)-one;1H-5,10b-Propeno-1,7-phenanthrolin-8(7H)-one, 2,3,4,4a,5,6-hexahydro-12-methyl-, (4aR,5R,10bR)-;Huperzine B USP/EP/BP;(4aR,5R,10bR)-12-Methyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8(7H)-one;Huperzine B-RM |
| CAS: | 103548-82-9 |
| MF: | C16H20N2O |
| MW: | 256.34 |
| EINECS: | |
| Product Categories: | reference substance |
| Mol File: | 103548-82-9.mol |
|
Huperzine B Chemical Properties
| Boiling point | 533.5±50.0 °C(Predicted) |
| density | 1.21±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMF:1.0(Max Conc. mg/mL);3.9(Max Conc. mM)
DMSO:1.0(Max Conc. mg/mL);3.9(Max Conc. mM)
Ethanol:2.0(Max Conc. mg/mL);7.8(Max Conc. mM) |
| form | A solid |
| pka | 12.92±0.40(Predicted) |
| color | White to off-white |
| InChI | InChI=1/C16H20N2O/c1-10-7-11-8-14-13(4-5-15(19)18-14)16(9-10)12(11)3-2-6-17-16/h4-5,7,11-12,17H,2-3,6,8-9H2,1H3,(H,18,19)/t11-,12+,16+/s3 |
| InChIKey | YYWGABLTRMRUIT-YQLZAFFXNA-N |
| SMILES | [C@@]123NCCC[C@]1([H])[C@]([H])(CC1NC(=O)C=CC2=1)C=C(C)C3 |&1:0,5,7,r| |
Safety Information
Huperzine B Usage And Synthesis
| Uses | Huperzine B is a plant-derived alkaloid displaying anti-cholinesterase activity. |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Melaleuca alternifolia, Huperzia serrata, and Cryptomeria japonica. |
| Uses | Huperzine B is a plant-derived alkaloid displaying anti-cholinesterase activity. |
| Definition | ChEBI: Huperzine b is a phenanthrol. |
Huperzine B Preparation Products And Raw materials
| Raw materials | Carbamic acid, N-[(3R,5S)-5-[(3-bromo-6-methoxy-2-pyridinyl)methyl]-3-methyl-6-oxo-1-cyclohexen-1-yl]-, 1,1-dimethylethyl ester-->Pyridine, 3-bromo-2-(bromomethyl)-6-methoxy--->(+)-PULEGONE |
