Introduction:Basic information about N,N'-Bis(methylphenyl)-1,4-benzenediamine CAS 27417-40-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N,N'-Bis(methylphenyl)-1,4-benzenediamine Basic information
| Product Name: | N,N'-Bis(methylphenyl)-1,4-benzenediamine |
| Synonyms: | -Bis(methylphenyl)-1,4-benzenediamine;N,N'-Ditolyl-p-phenylenediamine;N,N'-Ditolyl-1,4-phenylenediamine;N1,N4-Bis(methylphenyl)-1,4-benzenediamine;N,N-Ditolyl-1,4-Benzenediamine;1,4-Benzenediamine,N1,N4-bis(methylphenyl)-;Antioxidant DTPD;N,N'-Bis (Methylphenyl)-1,4-Benzenediamine |
| CAS: | 27417-40-9 |
| MF: | C20H20N2 |
| MW: | 288.39 |
| EINECS: | |
| Product Categories: | Industrial/Fine Chemicals |
| Mol File: | 27417-40-9.mol |
|
N,N'-Bis(methylphenyl)-1,4-benzenediamine Chemical Properties
| Melting point | 183.5-185.5 °C |
| storage temp. | Refrigerator |
| solubility | Acetone (Slightly), Benzene (Very Slightly), Chloroform (Slightly), DMSO (Very Slightly) |
| form | Solid |
| color | Dark Brown |
| InChI | InChI=1S/C20H20N2/c1-15-7-3-5-9-19(15)21-17-11-13-18(14-12-17)22-20-10-6-4-8-16(20)2/h3-14,21-22H,1-2H3 |
| InChIKey | MDZBMZIJIUEQJS-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1C)NC1=CC=C(NC2C=CC=CC=2C)C=C1 |
| LogP | 5.573 (est) |
| EPA Substance Registry System | 1,4-Benzenediamine, N,N'-bis(methylphenyl)- (27417-40-9) |
Safety Information
N,N'-Bis(methylphenyl)-1,4-benzenediamine Usage And Synthesis
| Chemical Properties | This product is a mixture of industrial products as blue-brown flakes or brown powder. Insoluble in water, soluble in benzene, toluene, chlorobenzene, acetone and chloroform, slightly soluble in ethanol, insoluble in petroleum ether and dilute hydrochloric acid. |
| Uses | N,N''''-Bis(methylphenyl)-1,4-benzenediamine is used in preparation of novel high-strength rubber sound insulation pad composite material. |
N,N'-Bis(methylphenyl)-1,4-benzenediamine Preparation Products And Raw materials