Introduction：Basic information about N,N'-Desethylene-N,N'-diforMyl Levofloxacin CAS 151377-74-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N,N'-Desethylene-N,N'-diforMyl Levofloxacin Basic information
| Product Name: | N,N'-Desethylene-N,N'-diforMyl Levofloxacin |
| Synonyms: | (S)-9-Fluoro-10-[forMyl[2-(forMylMethylaMino)ethyl]aMino]-2,3-dihydro-3-Methyl-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic Acid;Levofloxacin Desethylene DiforMyl IMpurity;N,N'-Desethylene-N,N'-diforMyl Levofloxacin;Levofloxacin DiforMyl IMpurity;(s)-ofloxacin Impurity;N,N'-Desethylene-N;Levofloxacin impurity;Levofloxacin IMP |
| CAS: | 151377-74-1 |
| MF: | C18H18FN3O6 |
| MW: | 391.35 |
| EINECS: | |
| Product Categories: | Chiral Reagents;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals |
| Mol File: | 151377-74-1.mol |
|
N,N'-Desethylene-N,N'-diforMyl Levofloxacin Chemical Properties
| Melting point | 179-181°C |
| Boiling point | 708.6±60.0 °C(Predicted) |
| density | 1.52±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) |
| form | Solid |
| pka | 5.02±0.40(Predicted) |
| color | Off-White to Tan |
| InChI | InChI=1S/C18H18FN3O6/c1-10-7-28-17-14-11(16(25)12(18(26)27)6-22(10)14)5-13(19)15(17)21(9-24)4-3-20(2)8-23/h5-6,8-10H,3-4,7H2,1-2H3,(H,26,27)/t10-/m0/s1 |
| InChIKey | HTOKHJLTWLBPPN-JTQLQIEISA-N |
| SMILES | O1C2=C(N(C=O)CCN(C=O)C)C(F)=CC3C(=O)C(C(O)=O)=CN(C2=3)[C@@H](C)C1 |
Safety Information
N,N'-Desethylene-N,N'-diforMyl Levofloxacin Usage And Synthesis
| Chemical Properties | Tan Solid |
| Uses | Levofloxacin (L360000) impurity. A photodegradation product of Levofloxacin (L360000) in aqueous solution. |
N,N'-Desethylene-N,N'-diforMyl Levofloxacin Preparation Products And Raw materials
