Introduction：Basic information about p-Coumaryl alcohol CAS 3690-05-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
p-Coumaryl alcohol Basic information
| Product Name: | p-Coumaryl alcohol |
| Synonyms: | p-Coumaryl alcohol;3-(4-hydroxyphenyl)-1-propane;3-(4-Hydroxyphenyl)allyl alcohol;3-(p-Hydroxyphenyl)-2-propen-1-ol;4-(3-Hydroxy-1-propenyl)phenol;p-Coumaric alcohol;p-Hydroxycinnamic alcohol;(E)-4-(3-hydroxyprop-1-enyl)phenol |
| CAS: | 3690-05-9 |
| MF: | C9H10O2 |
| MW: | 150.17 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 3690-05-9.mol |
|
p-Coumaryl alcohol Chemical Properties
| Melting point | 124 °C |
| Boiling point | 323.5±22.0 °C(Predicted) |
| density | 1.188±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.95±0.30(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | food and beverages |
| InChI | InChI=1S/C9H10O2/c10-7-1-2-8-3-5-9(11)6-4-8/h1-6,10-11H,7H2 |
| InChIKey | PTNLHDGQWUGONS-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C=CCO)C=C1 |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
p-Coumaryl alcohol Usage And Synthesis
| Uses | p-Coumaryl Alcohol is a monolignon which is used to synthesize lignin through a biosynthetic enzyme-catalyzed phenol dehydrogenation reaction. |
| Definition | ChEBI: A primary alcohol being cinnamyl alcohol hydroxylated at C-4 of the phenyl ring. |
p-Coumaryl alcohol Preparation Products And Raw materials
