Introduction：Basic information about Trifarotene CAS 895542-09-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Trifarotene Basic information
| Product Name: | Trifarotene |
| Synonyms: | 4-[3-(3-tert-butyl-4-pyrrolidin-1-ylphenyl)-4-(2-hydroxyethoxy)phenyl]benzoic acid;[1,1':3',1''-Terphenyl]-4-carboxylic acid, 3''-(1,1-dimethylethyl)-4'-(2-hydroxyethoxy)-4''-(1-pyrrolidinyl)-;Trifarotene (CD5789);3''-(tert-Butyl)-4'-(2-hydroxyethoxy)-4''-(pyrrolidin-1-yl)-[1,1':3',1''-terphenyl]-4-carboxylic acid;RAR/RXR,inhibit,trifarotene,CD-5789,Autophagy,RAR,Retinoid X receptors,acne,CD 5789,Retinoic acid receptors,Inhibitor,selective;Trofarotene.;trifarotene, 10 mM in DMSO;Qufarotine |
| CAS: | 895542-09-3 |
| MF: | C29H33NO4 |
| MW: | 459.58 |
| EINECS: | |
| Product Categories: | API |
| Mol File: | 895542-09-3.mol |
|
Trifarotene Chemical Properties
| storage temp. | Store at -20°C |
| solubility | DMSO:250.0(Max Conc. mg/mL);543.97(Max Conc. mM) |
| form | Solid |
| color | White to Off-White |
| InChIKey | MFBCDACCJCDGBA-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OCCO)C(C3=CC=C(N4CCCC4)C(C(C)(C)C)=C3)=C2)=CC=C(C(O)=O)C=C1 |
Safety Information
Trifarotene Usage And Synthesis
| Uses | Trifarotene, is a retinoic acid receptor (RAR) agonist. |
Trifarotene Preparation Products And Raw materials
