Introduction:Basic information about CAS 96293-19-5|NI-(S)-BPB-GLY, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | NI-(S)-BPB-GLY |
|---|
| CAS Number | 96293-19-5 | Molecular Weight | 498.19900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C27H25N3NiO3 | Melting Point | 219-222ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (s)-(o-(N-benzylprolyl)amino)(phenyl)methyleneiminoacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 219-222ºC |
|---|
| Molecular Formula | C27H25N3NiO3 |
|---|
| Molecular Weight | 498.19900 |
|---|
| Exact Mass | 497.12500 |
|---|
| PSA | 62.21000 |
|---|
| LogP | 3.43190 |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | DRZQCPMTUIIOMU-JIDHJSLPSA-M |
|---|
| SMILES | O=C(O)CN=C(c1ccccc1)c1ccccc1[N-]C(=O)C1CCCN1Cc1ccccc1.[Ni] |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Safety Phrases | S24/25 |
|---|
Synonyms
| (S)-2-{o-{(N-benzylprolyl)aMino}phenyl}-benzylideneaMino-acetato(2-)-N,N',N''-nickel(II) |
| NI-(S)-BPB-GLY |
| Ni-(S)-BPB-GLy(S)-[O-[(N-Benzylprolyl)amino](phenyl)methyleneiminoacetate(2-)-N,N',N''-nickel(II) |
| (S)-O-[(N-BENZYLPROLYL)AMINO](PHENYL)METHYLENEIMINOACETATE(2)-N,N',N''-NICKEL(II) |
| (s)-(o-(N-benzylprolyl)amino)(phenyl) |
| [N-[Phenyl[2-[[[1-(phenylmethyl)-2-pyrrolidinyl]carbonyl]amino]phenyl]methylene]glycinato(2-)-N,N',N'',O1]-nickel |