Introduction：Basic information about CAS 96743-96-3|2-[(3-benzyl-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl)oxy]-N,N-dimethylethanam, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(3-benzyl-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl)oxy]-N,N-dimethylethanamine |
|---|
| CAS Number | 96743-96-3 | Molecular Weight | 315.49300 |
|---|
| Density | 1g/cm3 | Boiling Point | 386.1ºC at 760mmHg |
|---|
| Molecular Formula | C21H33NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 113.7ºC |
|---|
Names
| Name | 2-[(3-benzyl-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl)oxy]-N,N-dimethylethanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1g/cm3 |
|---|
| Boiling Point | 386.1ºC at 760mmHg |
|---|
| Molecular Formula | C21H33NO |
|---|
| Molecular Weight | 315.49300 |
|---|
| Flash Point | 113.7ºC |
|---|
| Exact Mass | 315.25600 |
|---|
| PSA | 12.47000 |
|---|
| LogP | 4.39230 |
|---|
| Index of Refraction | 1.538 |
|---|
| InChIKey | XAZVHBVUJRRLHH-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)CCOC1(Cc2ccccc2)CC2CCC1(C)C2(C)C |
|---|
Synonyms
| UNII-I8AB3P944K |
| Ramciclane |
| Ramciclane [INN] |
