Introduction：Basic information about CAS 36950-96-6|9H-Fluorene-2-aceticacid, a-methyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9H-Fluorene-2-aceticacid, a-methyl- |
|---|
| CAS Number | 36950-96-6 | Molecular Weight | 238.28100 |
|---|
| Density | 1.234g/cm3 | Boiling Point | 423.2ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 320ºC |
|---|
Names
| Name | 2-(9H-fluoren-2-yl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.234g/cm3 |
|---|
| Boiling Point | 423.2ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O2 |
|---|
| Molecular Weight | 238.28100 |
|---|
| Flash Point | 320ºC |
|---|
| Exact Mass | 238.09900 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.44590 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | LRXFKKPEBXIPMW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C(=O)O)c1ccc2c(c1)Cc1ccccc1-2 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Cicloprofenum |
| CICLOPROFEN |
| (R,S)-2-(fluoren-2-yl)propanoic acid |
| Cicloprofeno |
| 2-(2-fluorenyl)propionic acid |
| 2-Fluoren-2-ylpropionic acid |
| Cicloprofene |
