Introduction：Basic information about CAS 25486-55-9|Vitamin K1 2,3-Oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Vitamin K1 2,3-Oxide |
|---|
| CAS Number | 25486-55-9 | Molecular Weight | 466.695 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 561.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C31H46O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.8±30.2 °C |
|---|
Names
| Name | vitamin K epoxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 561.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C31H46O3 |
|---|
| Molecular Weight | 466.695 |
|---|
| Flash Point | 233.8±30.2 °C |
|---|
| Exact Mass | 466.344696 |
|---|
| PSA | 46.67000 |
|---|
| LogP | 11.33 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | KUTXFBIHPWIDJQ-LKUDQCMESA-N |
|---|
| SMILES | CC(=CCC12OC1(C)C(=O)c1ccccc1C2=O)CCCC(C)CCCC(C)CCCC(C)C |
|---|
Synonyms
| Naphth[2,3-b]oxirene-2,7-dione, 1a,7a-dihydro-1a-methyl-7a-[(2E)-3,7,11,15-tetramethyl-2-hexadecen-1-yl]- |
| 1a-Methyl-7a-[(2E)-3,7,11,15-tetramethylhexadec-2-en-1-yl]-1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione |
| vitamin K1-2,3-<16>O-epoxide |
| vitamin K oxide |
| (2,3-epoxyphytyl)menaquinone |
| Vitamin K1 2,3-Oxide |
| Vitamin K1 2,3-epoxide |
| 1a,7a-Dihydro-7a-methyl-1a-(3,7,11,15-tetramethyl-2-hexadecenyl)naphth[2,3-b]oxirene-2,7-dione |
| 2-Methyl-3-phytyl-2,3-epoxy-2,3-dihydro-1,4-naphthoquinone |
| 1a-Methyl-7a-[(2E)-3,7,11,15-tetramethyl-2-hexadecen-1-yl]-1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione |
| 3-Phenyl-2-methyl-thiophen |
| Naphth[2,3-b]oxirene-2,7-dione, 1a,7a-dihydro-1a-methyl-7a-(3,7,11,15-tetramethyl-2-hexadecenyl)- |
| Vitamin K 2,3-epoxide |
| 2-Methyl-3-phenyl-thiophen |
| 2-methyl-3-phenyl-thiophene |
| 2-Methyl-3-phytyl-1,4-naphthoquinone 2,3-Oxide |
| (E)-vitamin K oxide |
