Introduction：Basic information about CAS 133083-36-0|Fmoc-D-Lys(Boc)-OPfp, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-D-Lys(Boc)-OPfp |
|---|
| CAS Number | 133083-36-0 | Molecular Weight | 634.59000 |
|---|
| Density | 1.324 | Boiling Point | 726.742ºC at 760 mmHg |
|---|
| Molecular Formula | C32H31F5N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 393.319ºC |
|---|
Names
| Name | (2,3,4,5,6-pentafluorophenyl) (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.324 |
|---|
| Boiling Point | 726.742ºC at 760 mmHg |
|---|
| Molecular Formula | C32H31F5N2O6 |
|---|
| Molecular Weight | 634.59000 |
|---|
| Flash Point | 393.319ºC |
|---|
| Exact Mass | 634.21000 |
|---|
| PSA | 102.96000 |
|---|
| LogP | 7.67160 |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | HLNVSYQQDWNJRI-JOCHJYFZSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NCCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
|---|
| Storage condition | -15°C |
|---|
Synonyms
| Fmoc-D-Lys(Boc)-Opfp |
| N'-(tert-Butoxycarbonyl)-N-(9-fluorenylmethyloxycarbonyl)-D-lysine pentafluorophenyl ester |
| fmoc-d-lys(boc)-opfp |
| Fmoc-D-Lys(Boc)-OC6F5 |
