Introduction：Basic information about CAS 160729-91-9|COMPOUND K, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | COMPOUND K |
|---|
| CAS Number | 160729-91-9 | Molecular Weight | 653.81000 |
|---|
| Density | 1.29g/cm3 | Boiling Point | 903.1ºC at 760mmHg |
|---|
| Molecular Formula | C38H47N5O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 500ºC |
|---|
Names
| Name | (2S)-1-[(2S,4R)-4-benzyl-2-hydroxy-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-5-oxopentyl]-N-tert-butyl-4-(furo[2,3-b]pyridin-5-ylmethyl)piperazine-2-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Boiling Point | 903.1ºC at 760mmHg |
|---|
| Molecular Formula | C38H47N5O5 |
|---|
| Molecular Weight | 653.81000 |
|---|
| Flash Point | 500ºC |
|---|
| Exact Mass | 653.35800 |
|---|
| PSA | 131.17000 |
|---|
| LogP | 4.27070 |
|---|
| Vapour Pressure | 3.97E-35mmHg at 25°C |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | UBUFVRJUGFJQSI-PPJSLLJVSA-N |
|---|
| SMILES | CC(C)(C)NC(=O)C1CN(Cc2cnc3occc3c2)CCN1CC(O)CC(Cc1ccccc1)C(=O)NC1c2ccccc2CC1O |
|---|
