Introduction：Basic information about CAS 61338-19-0|3-Quinolinecarbonitrile,4-hydroxy-8-(methylsulfonyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Quinolinecarbonitrile,4-hydroxy-8-(methylsulfonyl)- |
|---|
| CAS Number | 61338-19-0 | Molecular Weight | 248.25800 |
|---|
| Density | 1.55g/cm3 | Boiling Point | 567.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 297.2ºC |
|---|
Names
| Name | 4-Hydroxy-8-(methylsulfonyl)-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.55g/cm3 |
|---|
| Boiling Point | 567.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8N2O3S |
|---|
| Molecular Weight | 248.25800 |
|---|
| Flash Point | 297.2ºC |
|---|
| Exact Mass | 248.02600 |
|---|
| PSA | 99.17000 |
|---|
| LogP | 1.88408 |
|---|
| Index of Refraction | 1.697 |
|---|
| InChIKey | DUQVSPFFDLGQNT-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1cccc2c(=O)c(C#N)c[nH]c12 |
|---|
