Introduction：Basic information about CAS 61338-21-4|4-oxo-8-propan-2-yl-1H-quinoline-3-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-oxo-8-propan-2-yl-1H-quinoline-3-carbonitrile |
|---|
| CAS Number | 61338-21-4 | Molecular Weight | 212.24700 |
|---|
| Density | 1.19g/cm3 | Boiling Point | 332.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-oxo-8-propan-2-yl-1H-quinoline-3-carbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.19g/cm3 |
|---|
| Boiling Point | 332.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12N2O |
|---|
| Molecular Weight | 212.24700 |
|---|
| Exact Mass | 212.09500 |
|---|
| PSA | 56.65000 |
|---|
| LogP | 2.52318 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | HYGMZVLYPOOZQU-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1cccc2c(=O)c(C#N)c[nH]c12 |
|---|
