Introduction：Basic information about CAS 964-82-9|Xenyhexenic, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Xenyhexenic |
|---|
| CAS Number | 964-82-9 | Molecular Weight | 266.33400 |
|---|
| Density | 1.098g/cm3 | Boiling Point | 427.5ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 324.2ºC |
|---|
Names
| Name | (E)-2-(4-phenylphenyl)hex-4-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.098g/cm3 |
|---|
| Boiling Point | 427.5ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O2 |
|---|
| Molecular Weight | 266.33400 |
|---|
| Flash Point | 324.2ºC |
|---|
| Exact Mass | 266.13100 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.48800 |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | ZVRCODPBROUJIT-NSCUHMNNSA-N |
|---|
| SMILES | CC=CCC(C(=O)O)c1ccc(-c2ccccc2)cc1 |
|---|
Synonyms
| 2-(4-Biphenylyl)-4-hexensaeure |
| SCR157 |
| Acide xenyhexenique [INN-French] |
| Desenovister |
| Diphenesenic acid |
| Acido seniesenico [DCIT] |
| Darilin |
| Desenovis |
| Diphenesinsaeure |
| Xenyhexenic Acid |
