Introduction：Basic information about CAS 13152-94-8|3,4'-dimethylbenzophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4'-dimethylbenzophenone |
|---|
| CAS Number | 13152-94-8 | Molecular Weight | 210.27100 |
|---|
| Density | 1.05g/cm3 | Boiling Point | 354.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H14O | Melting Point | 70-74 °C |
|---|
| MSDS | / | Flash Point | 153.7ºC |
|---|
Names
| Name | (3-methylphenyl)-(4-methylphenyl)methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.05g/cm3 |
|---|
| Boiling Point | 354.1ºC at 760mmHg |
|---|
| Melting Point | 70-74 °C |
|---|
| Molecular Formula | C15H14O |
|---|
| Molecular Weight | 210.27100 |
|---|
| Flash Point | 153.7ºC |
|---|
| Exact Mass | 210.10400 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.53440 |
|---|
| Vapour Pressure | 3.43E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | YMDBXBBWNOELNV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(=O)c2cccc(C)c2)cc1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S24/25 |
|---|
| HS Code | 2914399090 |
|---|
Customs
| HS Code | 2914399090 |
|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| 3,4'-dimethylbenzophenone |
| (3-methylphenyl)(4-methylphenyl)methanone |
| EINECS 219-916-9 |
| di3-methylphenyl ketone |
| MFCD00236040 |
| m-tolyl-p-tolyl-methanone |
| 3,4'-Dimethyl-benzophenon |
| m-Tolyl-p-tolyl-keton |
