Introduction：Basic information about CAS 791789-61-2|SB-699551, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | SB-699551 |
|---|
| CAS Number | 791789-61-2 | Molecular Weight | 511.741 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 663.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C34H47Cl2N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 355.0±31.5 °C |
|---|
Names
| Name | 3-cyclopentyl-N-[2-(dimethylamino)ethyl]-N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]propanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 663.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C34H47Cl2N3O |
|---|
| Molecular Weight | 511.741 |
|---|
| Flash Point | 355.0±31.5 °C |
|---|
| Exact Mass | 511.356262 |
|---|
| PSA | 35.58000 |
|---|
| LogP | 7.05 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | SEQAMPXQRKYYQF-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)CCN(Cc1ccc(-c2ccc(CNCCc3ccccc3)cc2)cc1)C(=O)CCC1CCCC1 |
|---|
Synonyms
| Cyclopentanepropanamide, N-[2-(dimethylamino)ethyl]-N-[[4'-[[(2-phenylethyl)amino]methyl][1,1'-biphenyl]-4-yl]methyl]- |
| SB-699551 |
| 3-Cyclopentyl-N-[2-(dimethylamino)ethyl]-N-[(4'-{[(2-phenylethyl)amino]methyl}-4-biphenylyl)methyl]propanamide |
| sb-699,551 |
