Introduction：Basic information about CAS 138-25-0|dimethyl 5-sulphoisophthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethyl 5-sulphoisophthalate |
|---|
| CAS Number | 138-25-0 | Molecular Weight | 274.24700 |
|---|
| Density | 1.458g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H10O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3,5-bis(methoxycarbonyl)benzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.458g/cm3 |
|---|
| Molecular Formula | C10H10O7S |
|---|
| Molecular Weight | 274.24700 |
|---|
| Exact Mass | 274.01500 |
|---|
| PSA | 115.35000 |
|---|
| LogP | 1.58730 |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | HTXMGVTWXZBZNC-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)O)c1 |
|---|
Synonyms
| 1,3-Benzenedicarboxylic acid,5-sulfo-,1,3-dimethyl ester |
| Isophthalic acid,5-sulfo-,1,3-dimethyl ester |
| EINECS 205-320-6 |
| Dimethyl 5-sulphoisophthalate |
