Introduction：Basic information about CAS 96613-89-7|1-deoxy-1-nitro-d-iditol hemihydrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-deoxy-1-nitro-d-iditol hemihydrate |
|---|
| CAS Number | 96613-89-7 | Molecular Weight | 229.18500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6H15NO8 | Melting Point | 88ºC(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-deoxy-1-nitro-d-iditol hemihydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 88ºC(lit.) |
|---|
| Molecular Formula | C6H15NO8 |
|---|
| Molecular Weight | 229.18500 |
|---|
| Exact Mass | 229.08000 |
|---|
| PSA | 156.20000 |
|---|
| InChIKey | OHFQXMNDKUHFDU-QAYODLCCSA-N |
|---|
| SMILES | O.O=[N+]([O-])CC(O)C(O)C(O)C(O)CO |
|---|
Safety Information
| Safety Phrases | 24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2905590090 |
|---|
Customs
| HS Code | 2905590090 |
|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Conray 60 |
| 1-Deoxy-1-nitro-D-iditol |
| Meglumine Meglumin-iothalamat |
| Contrix 28 |
| Conray meglumin |
| 1-deoxy-1-nitro-D-ido-hexitol |
| Conray |
| Cysto-Conray |
