Introduction：Basic information about CAS 16108-03-5|N-Formyltryptophan, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Formyltryptophan |
|---|
| CAS Number | 16108-03-5 | Molecular Weight | 232.235 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 590.4±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H12N2O3 | Melting Point | 167ºC |
|---|
| MSDS | / | Flash Point | 310.9±28.7 °C |
|---|
Names
| Name | Nalpha-Formyl-DL-tryptophan |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 590.4±45.0 °C at 760 mmHg |
|---|
| Melting Point | 167ºC |
|---|
| Molecular Formula | C12H12N2O3 |
|---|
| Molecular Weight | 232.235 |
|---|
| Flash Point | 310.9±28.7 °C |
|---|
| Exact Mass | 232.084793 |
|---|
| PSA | 82.19000 |
|---|
| LogP | 1.17 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.664 |
|---|
| InChIKey | RNEMLJPSSOJRHX-UHFFFAOYSA-N |
|---|
| SMILES | O=CNC(Cc1c[nH]c2ccccc12)C(=O)O |
|---|
| Storage condition | -20°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S22-S24/25 |
|---|
Synonyms
| N-Formyl-DL-tryptophan |
| 2-Formamido-3-(1H-indol-3-yl)propanoic acid |
| Nα-Formyl-DL-tryptophan |
| Nalpha-ForMyl-DL-tryptophan |
| N-Formyltryptophan |
| Tryptophan, N-formyl- |
| Formyl-DL-Trp-OH |
