Introduction：Basic information about CAS 169338-17-4|(4R,5S)-(2,2-DIMETHYL-5-VINYL-1,3-DIOXOLAN-4-YL)METHAN-1-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4R,5S)-(2,2-DIMETHYL-5-VINYL-1,3-DIOXOLAN-4-YL)METHAN-1-OL |
|---|
| CAS Number | 169338-17-4 | Molecular Weight | 251.27800 |
|---|
| Density | 1.267g/cm3 | Boiling Point | 457.8ºC at 760mmHg |
|---|
| Molecular Formula | C13H17NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.6ºC |
|---|
Names
| Name | (2S,4S)-2-amino-4-(4-methylbenzyl)pentanedioic acid |
|---|
Chemical & Physical Properties
| Density | 1.267g/cm3 |
|---|
| Boiling Point | 457.8ºC at 760mmHg |
|---|
| Molecular Formula | C13H17NO4 |
|---|
| Molecular Weight | 251.27800 |
|---|
| Flash Point | 230.6ºC |
|---|
| Exact Mass | 251.11600 |
|---|
| PSA | 100.62000 |
|---|
| LogP | 1.74060 |
|---|
| Vapour Pressure | 3.58E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | RGKAJUJNUGDWKC-QWRGUYRKSA-N |
|---|
| SMILES | Cc1ccc(CC(CC(N)C(=O)O)C(=O)O)cc1 |
|---|
