Introduction：Basic information about CAS 16934-09-1|5-Bromo-3-indolyl-beta-D-glucopyranoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Bromo-3-indolyl-beta-D-glucopyranoside |
|---|
| CAS Number | 16934-09-1 | Molecular Weight | 374.18400 |
|---|
| Density | 1.824g/cm3 | Boiling Point | 646.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H16BrNO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 344.9ºC |
|---|
Names
| Name | 5-Bromo-3-indolyl b-D-glucopyranoside |
|---|
Chemical & Physical Properties
| Density | 1.824g/cm3 |
|---|
| Boiling Point | 646.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H16BrNO6 |
|---|
| Molecular Weight | 374.18400 |
|---|
| Flash Point | 344.9ºC |
|---|
| Exact Mass | 373.01600 |
|---|
| PSA | 115.17000 |
|---|
| LogP | 0.10910 |
|---|
| Vapour Pressure | 1.33E-17mmHg at 25°C |
|---|
| Index of Refraction | 1.73 |
|---|
| InChIKey | LINMATFDVHBYOS-RKQHYHRCSA-N |
|---|
| SMILES | OCC1OC(Oc2c[nH]c3ccc(Br)cc23)C(O)C(O)C1O |
|---|
