Introduction：Basic information about CAS 96164-19-1|Peraclopone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Peraclopone |
|---|
| CAS Number | 96164-19-1 | Molecular Weight | 408.32200 |
|---|
| Density | 1.286g/cm3 | Boiling Point | 569.901ºC at 760 mmHg |
|---|
| Molecular Formula | C20H23Cl2N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 298.465ºC |
|---|
Names
| Name | 1-[(E)-(4-chlorophenyl)methylideneamino]oxy-3-[4-(2-chlorophenyl)piperazin-1-yl]propan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.286g/cm3 |
|---|
| Boiling Point | 569.901ºC at 760 mmHg |
|---|
| Molecular Formula | C20H23Cl2N3O2 |
|---|
| Molecular Weight | 408.32200 |
|---|
| Flash Point | 298.465ºC |
|---|
| Exact Mass | 407.11700 |
|---|
| PSA | 48.30000 |
|---|
| LogP | 3.52990 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | IAKCDZCRAWGHFD-YDZHTSKRSA-N |
|---|
| SMILES | OC(CON=Cc1ccc(Cl)cc1)CN1CCN(c2ccccc2Cl)CC1 |
|---|
Synonyms
| UNII-231HZQ66PD |
| Peraclopone |
| Peraclopone [INN] |
