Introduction：Basic information about CAS 138-42-1|p-Nitrophenylsulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-Nitrophenylsulfonic acid |
|---|
| CAS Number | 138-42-1 | Molecular Weight | 203.173 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C6H5NO5S | Melting Point | 105-112 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-Nitrobenzenesulfonic Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Melting Point | 105-112 °C |
|---|
| Molecular Formula | C6H5NO5S |
|---|
| Molecular Weight | 203.173 |
|---|
| Exact Mass | 202.988846 |
|---|
| PSA | 108.57000 |
|---|
| LogP | 0.67 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | SPXOTSHWBDUUMT-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)O)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant;C: Corrosive; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S37/39-S26 |
|---|
| RIDADR | 2305 |
|---|
| Hazard Class | 8.0 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-Nitrobenzenesulfonic acid |
| 4-Nitrobenzenesulfonic acid hydrate |
| p-Nitrophenylsulfonic acid |
| 4-Nitro-benzenesulfonic acid |
| 4-nitrobenzenesulphonic acid |
| 4-Nitrobenzene-1-sulfonic acid |
| Benzenesulfonic acid, 4-nitro- |
| p-Nitrobenzenesulfonic acid |
| EINECS 205-329-5 |
| MFCD00041886 |
