CAS 96562-88-8|szechenyine
Introduction:Basic information about CAS 96562-88-8|szechenyine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | szechenyine | ||
|---|---|---|---|
| CAS Number | 96562-88-8 | Molecular Weight | 673.790 |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 711.0±60.0 °C at 760 mmHg |
| Molecular Formula | C36H51NO11 | Melting Point | / |
| MSDS | / | Flash Point | 383.8±32.9 °C |
Names
| Name | Aconitane-3,13,14,15-tetrol, 8-ethoxy-20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)-, 3-acetate 14-benzoate, (1α,3α,6α,14α,15α,16β) |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 711.0±60.0 °C at 760 mmHg |
| Molecular Formula | C36H51NO11 |
| Molecular Weight | 673.790 |
| Flash Point | 383.8±32.9 °C |
| Exact Mass | 673.346191 |
| PSA | 142.45000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | DXAQZKJLRXMIFW-UXFCHLKDSA-N |
| SMILES | CCOC12C(O)C(OC)C3(O)CC(C1C3OC(=O)c1ccccc1)C13C(OC)CC(OC(C)=O)C4(COC)CN(CC)C1C2C(OC)C43 |
Safety Information
| Hazard Codes | Xi |
|---|
Synonyms
| 3-Acetyl-8-O-ethyl-14-benzoylaconine |
| 8-O-Ethylaconine 3-acetate 14-benzoate |
| (1α,3α,5ξ,6α,9ξ,10α,14α,15α,16β,17ξ)-3-Acetoxy-8-ethoxy-20-ethyl-13,15-dihydroxy-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl benzoate |
| Aconitane-3,13,14,15-tetrol, 8-ethoxy-20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)-, 3-acetate 14-benzoate, (1α,3α,5ξ,6α,9ξ,10α,14α,15α,16β,17ξ)- |
| O8-Ethylpolyschistine D |
| 2H-12,3,6a-Ethanylylidene-7,9-methanonaphth[2,3-b]azocine, aconitane-3,13,14,15-tetrol deriv. |
| Cattle seven bases |
| (1α,3α,6α,14α,15α,16β,17S)-3-Acetoxy-8-ethoxy-20-ethyl-13,15-dihydroxy-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl benzoate |
| 3-O-Acetyl-14-O-benzoyl-8-O-ethylaconine |
| Aconitane-3,13,14,15-tetrol, 8-ethoxy-20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)-, 3-acetate 14-benzoate, (1α,3α,6α,14α,15α,16β,17S)- |
| SZECHENYINE |
