Introduction：Basic information about CAS 966-62-1|Benzo[a]phenoxazin-7-ium,9-(dimethylamino)-, chloride (1:1), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzo[a]phenoxazin-7-ium,9-(dimethylamino)-, chloride (1:1) |
|---|
| CAS Number | 966-62-1 | Molecular Weight | 310.77800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H15ClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | benzo[a]phenoxazin-9-ylidene(dimethyl)azanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H15ClN2O |
|---|
| Molecular Weight | 310.77800 |
|---|
| Exact Mass | 310.08700 |
|---|
| PSA | 29.27000 |
|---|
| LogP | 1.48530 |
|---|
| InChIKey | HWYNRVXFYFQSID-UHFFFAOYSA-M |
|---|
| SMILES | C[N+](C)=c1ccc2nc3c(ccc4ccccc43)oc-2c1.[Cl-] |
|---|
Synonyms
| benzo[a]phenoxazin-9-ylidenedimethylamine,chloride |
| meldola blue |
| 9-Dimethylamino-benzo[a]phenoxazinylium,Chlorid |
| 9-(Dimethylamino)benzo(a)phenazin-7-ium chloride,compound with zinc chloride |
| Phenylene Blue |
| 7-dimethylamino-1,2-benzophenoxazine hydrochloride |
| Meldola's blue |
| 7-(dimethylamino)-1,2-benzophenoxazine chloride |
| naphthol blue |
| Benzo(a)phenoxazin-7-ium,9-(dimethylamino)-,chloride |
| 9-dimethylamino-benzo[a]phenoxazinylium,chloride |
| C.I. Basic Blue 6 |
