Introduction：Basic information about CAS 61081-34-3|1-(methylsulfonylmethyl)-4-nitro-benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(methylsulfonylmethyl)-4-nitro-benzene |
|---|
| CAS Number | 61081-34-3 | Molecular Weight | 215.22600 |
|---|
| Density | 1.387g/cm3 | Boiling Point | 459.8ºC at 760 mmHg |
|---|
| Molecular Formula | C8H9NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 231.9ºC |
|---|
Names
| Name | 1-(methylsulfonylmethyl)-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.387g/cm3 |
|---|
| Boiling Point | 459.8ºC at 760 mmHg |
|---|
| Molecular Formula | C8H9NO4S |
|---|
| Molecular Weight | 215.22600 |
|---|
| Flash Point | 231.9ºC |
|---|
| Exact Mass | 215.02500 |
|---|
| PSA | 88.34000 |
|---|
| LogP | 2.74340 |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | XJQWZUJNHLGBQG-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| o-bromo-p-nitrobenzoic acid |
| methyl 4-nitro-2-bromobenzoic acid |
| Methyl-(4-nitro-benzyl)-sulfon |
| methyl-(4-nitro-benzyl)-sulfone |
| 1-[(methylsulphonyl)methyl]-4-nitrobenzene |
| 2-Brom-4-nitro-benzoesaeure |
| 2-bromo-4-nitro-benzoic acid |
| <<(4-nitrophenyl)methyl>sulphonyl>methane |
