Introduction:Basic information about CAS 36284-77-2|Hederasaponin B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hederasaponin B |
|---|
| CAS Number | 36284-77-2 | Molecular Weight | 1205.379 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C59H96O25 | Melting Point | 223-226 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-β-[(O-α-L-rhamnopyranosyl-(1->2)-α-L-arabinopyranosyl)oxy]olean-12-en-28-oic acid O-α-L-rhamnopyranosyl-(1->4)-β-D-glucopyranosyl-(1-->6)-β-D-glucopyranosyl ester |
|---|
| Synonym | More Synonyms |
|---|
Hederasaponin B BiologicalActivity
| Description | Hederasaponin B, isolated from Hedera helix, has broad-spectrum antiviral activity against various subgenotypes of Enterovirus 71 (EV71). |
|---|
| Related Catalog | Research Areas >>Infection |
|---|
| References | [1]. Song J, et al. Antiviral Activity of Hederasaponin B from Hedera helix against Enterovirus 71 Subgenotypes C3 and C4a. Biomol Ther (Seoul). 2014 Jan;22(1):41-6. |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Melting Point | 223-226 °C |
|---|
| Molecular Formula | C59H96O25 |
|---|
| Molecular Weight | 1205.379 |
|---|
| Exact Mass | 1204.624023 |
|---|
| PSA | 392.59000 |
|---|
| LogP | 6.11 |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | NVSLBOBPSCMMSO-BVLVEXITSA-N |
|---|
| SMILES | CC1OC(OC2C(CO)OC(OCC3OC(OC(=O)C45CCC(C)(C)CC4C4=CCC6C7(C)CCC(OC8OCC(O)C(O)C8OC8OC(C)C(O)C(O)C8O)C(C)(C)C7CCC6(C)C4(C)CC5)C(O)C(O)C3O)C(O)C2O)C(O)C(O)C1O |
|---|
Synonyms
| Hedera-saponin-B |
| Hedera saponin B |
| 6-Deoxy-α-L-mannopyranosyl-(1->4)-β-D-glucopyranosyl-(1->6)-1-O-[(3β)-3-{[2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy}-28-oxoolean-12-en-28-yl]-β-D-glucopyranose |
| β-D-Glucopyranose, O-6-deoxy-α-L-mannopyranosyl-(1->4)-O-β-D-glucopyranosyl-(1->6)-1-O-[(3β)-3-[[2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy]-28-oxoolean-12-en-28-yl ]- |
| hederasaponin B |
| HederasaponinB |