Introduction:Basic information about 1-DEOXY-1-(OCTYLAMINO)-D-GLUCITOL CAS 23323-37-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-DEOXY-1-(OCTYLAMINO)-D-GLUCITOL Basic information
| Product Name: | 1-DEOXY-1-(OCTYLAMINO)-D-GLUCITOL |
| Synonyms: | 1-DEOXY-1-(OCTYLAMINE)-D-GLUCITOL;1-DEOXY-1-(OCTYLAMINO)-D-GLUCITOL;1-Deoxy-1-(n-octylamino)-D-glucitol;(2R,3R,4R,5S)-6-(octylamino)hexane-1,2,3,4,5-pentol;1-Octylamino-1-deoxy-D-glucitol ,98%;(2R,3R,4R,5S)-6-(OctylaMino)hexane-1,2,3,4,5-pentaol;1-Deoxy-1-(n-OCLylaMino)-D-Glucitol;N-n-octylglucamine |
| CAS: | 23323-37-7 |
| MF: | C14H31NO5 |
| MW: | 293.4 |
| EINECS: | 245-582-9 |
| Product Categories: | chiral;Carbohydrate Synthesis;Monosaccharides;Specialty Synthesis |
| Mol File: | 23323-37-7.mol |
|
1-DEOXY-1-(OCTYLAMINO)-D-GLUCITOL Chemical Properties
| Melting point | 121-124 °C(lit.) |
| alpha | -15 º (c=1, MeOH) |
| Boiling point | 524.7±50.0 °C(Predicted) |
| density | 1.139±0.06 g/cm3(Predicted) |
| refractive index | -19 ° (C=0.5, MeOH) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Slightly) |
| pka | 13.47±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| Optical Rotation | [α]20/D 15°, c = 1 in methanol |
| InChI | InChI=1S/C14H31NO5/c1-2-3-4-5-6-7-8-15-9-11(17)13(19)14(20)12(18)10-16/h11-20H,2-10H2,1H3/t11-,12+,13+,14+/m0/s1 |
| InChIKey | ZRRNJJURLBXWLL-REWJHTLYSA-N |
| SMILES | C(NCCCCCCCC)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| CAS DataBase Reference | 23323-37-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |
1-DEOXY-1-(OCTYLAMINO)-D-GLUCITOL Usage And Synthesis
| Chemical Properties | white to light yellow crystal powde |
| Uses | 1-Deoxy-1-(octylamino)-D-glucitol is used in the preparation of Dexketoprofen Trometamol. |
| Synthesis | (1) Preparation of catalyst: 30g NaOH dissolved in 120ml of water, ice water bath cold to zero degree, electric stirring slowly add 30g aluminum - nickel alloy, reaction below 25 degrees Celsius for 2-3 hours, continue stirring for 0.5 hours, placed at room temperature for 2-3 hours, warmed to 95-100 degrees Celsius to continue the reaction for 2-3 hours, washed with water to neutral, and then washed with ethanol 3 times. The prepared RaneyNi was kept under ethanol level for storage. 2) Preparation of co-catalyst ZCMT3??Preparation of Glucosamine: put n-octylamine, glucose, solvent and catalyst into a high-pressure reactor according to a certain proportionate amount, seal it, pass hydrogen to 1.2~1.4Mpa, raise the temperature to 55~65 degrees Celsius, after 2 hours of reaction, cool and precipitate the white crystals, filter it, and dry it for 2 hours at 70 degrees Celsius, and then get the product. After the reaction was completed, the reaction solution was allowed to cool naturally, the product crystallized, separated by centrifugation, and the product was washed twice with mixed solvents and dried to obtain the product. |
1-DEOXY-1-(OCTYLAMINO)-D-GLUCITOL Preparation Products And Raw materials
| Preparation Products | (S)-(+)-Ibuprofen-->Levomefolic Acid |