Introduction：Basic information about Alizarin Red S CAS 130-22-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Alizarin Red S Basic information
| Product Name: | Alizarin Red S |
| Synonyms: | Alizarin Red S, certified, pure;ALIZARIN RED S SOLUTION 1% AQUEOUS;Alazarin red s.;ALIZARINSODIUMSULPHONATE;ALIZARINSODIUMSULPHATE;dihydroxyanthraquinone-sulfonic acid sodium salt;Alizarin Red S sodium salt, 1% w/v aq. sol.;Alizarine Red S (C.I. 58005) |
| CAS: | 130-22-3 |
| MF: | C14H7NaO7S |
| MW: | 342.26 |
| EINECS: | 204-981-8 |
| Product Categories: | Anthraquinone;marker;Dyes and Pigments |
| Mol File: | 130-22-3.mol |
|
Alizarin Red S Chemical Properties
| Melting point | >250°C |
| Boiling point | 287-289°C |
| storage temp. | room temp |
| solubility | H2O: soluble1mg/mL |
| pka | 4.5, 11(at 25℃) |
| Colour Index | 58005 |
| form | Powder |
| color | Various |
| PH Range | 4.3(yellow)-6.3(violet) |
| Water Solubility | Soluble in water and alcohol. |
| λmax | 556nm, 596nm, 423nm, 546nm |
| Merck | 14,8573 |
| BRN | 4117090 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | Nanocomposite material, chemical mechanical polishing, optical fibers, display device, carbon nanotubes, textiles, determination of aluminum,iron,copper,manganese,zinc,calcium,magnesium,zirconium,hafnium,molybdenum,uranium,vanadium, detergents, hair dyes, determination of proteins,clotrimazole,ketoconazole,piroxicam,and tenoxicam |
| Biological Applications | Detecting Candida,lactic acid bacteria,microorganisms; treating gastropathy,viral diseases |
| InChI | 1S/C14H8O7S.Na/c15-11-6-3-1-2-4-7(6)12(16)10-8(11)5-9(22(19,20)21)13(17)14(10)18;/h1-5,17-18H,(H,19,20,21);/q;+1/p-1 |
| InChIKey | HFVAFDPGUJEFBQ-UHFFFAOYSA-M |
| SMILES | [Na+].Oc1c(O)c(cc2C(=O)c3ccccc3C(=O)c12)S([O-])(=O)=O |
| CAS DataBase Reference | 130-22-3(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium alizarinesulfonate (130-22-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CB1095300 |
| TSCA | TSCA listed |
| HS Code | 32049090 |
| Storage Class | 11 - Combustible Solids |
Alizarin Red S Usage And Synthesis
| Chemical Properties | yellow-orange powder |
| Uses | Alizarin Red S is used in the biochemical assay to determine the presence of calcium. |
| Uses | Alizarin Red S sodium salt is used as a chromogenic agent for the colorimetric determination of dothiepin hydrochloride in pharmaceutical formulations. It is also used as an ion-pair reagent for the spectrophotometric assay of fexofenadine in pharmaceuticals. It acts as a colorometric pH indicator in the range of 3.8-5.4. Further, it is used in a biochemical assay to determine the presence of calcific deposition by cells of an osteogenic lineage. |
| Definition | ChEBI: An organic sodium salt having 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate as the counterion. It is commonly used to stain embryo skeletons in cleared whole mounts, usually of small mammals. |
| Preparation | Alizarin Red S was prepared by reacting 1,2-Dihydroxyanthracene-9,10-dione with fuming sulfuric acid sulphonate, and translated into Sodium salt. |
| Biochem/physiol Actions | Alizarin Red S is used for the staining of cartilage and bone. It reacts with calcium, thereby helping in the diagnosis of calcium deposits. It is also used to study carbohydrate–boronic acid interactions. |
| Properties and Applications | dark blue light red (chromium), brilliant yellow red (aluminum). Claybank powder. Soluble in Cellosolve, slightly soluble in ethanol and Acetone. In concentrated sulfuric acid to orange, dilution to pale yellow.
| Standard | Ironing Fastness | Light Fastness | Fulling | Persperation Fastness | Soaping | Water | | Alkali | Acid | | ISO | 3 | 6 | 4-5 | 1 | 4-5 | 5 | 5 | | AATCC | 3-4 | 6-7 | 3 | | 5 | 4 | 4 | |
Alizarin Red S Preparation Products And Raw materials
| Raw materials | 1-Hydroxy-2,1-benzoxaborolane-->Alizarin |
