Introduction：Basic information about Brompheniramine CAS 86-22-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Brompheniramine Basic information
| Product Name: | Brompheniramine |
| Synonyms: | BROMPHENIRAMINE;1-(p-bromophenyl)-1-(2-pyridyl)-3-dimethylaminopropane;2-[p-bromo-alpha-(2-dimethylaminoethyl)benzyl]pyridine;2-[p-Bromo-alpha-[2-(dimethylamino)ethyl]benzyl]pyridine;2-Pyridinepropanamine, gamma-(4-bromophenyl)-N,N-dimethyl-;3-(4-Bromophenyl)-N,N-dimethyl-3-(2-pyridinyl)-1-propanamine;3-(p-bromophenyl)-3-(2-pyridyl)-n,n-dimethylpropylamine;BROMPHENIRAMINE BASE |
| CAS: | 86-22-6 |
| MF: | C16H19BrN2 |
| MW: | 319.24 |
| EINECS: | 201-657-8 |
| Product Categories: | API;PAXIL |
| Mol File: | 86-22-6.mol |
|
Brompheniramine Chemical Properties
| Melting point | 25°C |
| Boiling point | bp0.5 147-152° |
| density | 1.3740 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | pKa 3.59 (Uncertain) |
| form | Oil |
| color | Colourless |
| InChI | InChI=1S/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 |
| InChIKey | ZDIGNSYAACHWNL-UHFFFAOYSA-N |
| SMILES | C1(C(C2=CC=C(Br)C=C2)CCN(C)C)=NC=CC=C1 |
| CAS DataBase Reference | 86-22-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Brompheniramine(86-22-6) |
| EPA Substance Registry System | 2-Pyridinepropanamine, .gamma.-(4-bromophenyl)-N,N-dimethyl- (86-22-6) |
Safety Information
| TSCA | TSCA listed |
| Hazardous Substances Data | 86-22-6(Hazardous Substances Data) |
Brompheniramine Usage And Synthesis
| Uses | antidepressant |
| Uses | Brompheniramine is also used for allergy symptoms, rhinitis, and dermatitis. Its activity isapproximately the same as that of chlorpheniramine. Synonyms of this drug are dimetane,brombey, spentan, veltane, and others. |
| Definition | ChEBI: Pheniramine in which the hydrogen at position 4 of the phenyl substituent is substituted by bromine. A histamine H1 receptor antagonist, brompheniramine is used (commonly as its maleate salt) for the symptomatic relief of allergic condtions, including rhinitis and conjunctivitis. |
| Brand name | Dimetane (Wyeth). |
Brompheniramine Preparation Products And Raw materials
