Introduction:Basic information about CYCLO (ARG-GLY-ASP-D-PHE-LYS) CAS 161552-03-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
CYCLO (ARG-GLY-ASP-D-PHE-LYS) Basic information
| Product Name: | CYCLO (ARG-GLY-ASP-D-PHE-LYS) |
| Synonyms: | CYCLO(-RGDFK);CYCLO (ARG-GLY-ASP-D-PHE-LYS);cyclo (Arg-Gly-Asp-Phe-Lys);Cyclic RGDFK peptide;Cyclo(L-arginylglycyl-L-alpha-aspartyl-D-phenylalanyl-L-lysyl);Cyclo(-Arg-Gly-Asp-D-Phe-Lys)Trifluoroacetate salt;c(RGDfK);Cyclo (-RGDfK) TFA |
| CAS: | 161552-03-0 |
| MF: | C27H41N9O7 |
| MW: | 603.67 |
| EINECS: | |
| Product Categories: | peptide;RGD |
| Mol File: | Mol File |
|
CYCLO (ARG-GLY-ASP-D-PHE-LYS) Chemical Properties
| Melting point | 191℃ (decomposition) |
| density | 1.47±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | ≥30.19 mg/mL in DMSO; insoluble in EtOH; ≥59.2 mg/mL in H2O |
| form | Powder |
| pka | 4.01±0.10(Predicted) |
| color | White to off-white |
| Sequence | Cyclo(Arg-Gly-Asp-Phe-Lys) |
| InChIKey | NVHPXYIRNJFKTE-HAGHYFMRSA-N |
| SMILES | [C@@H]1(NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC1=O)CC1C=CC=CC=1 |
Safety Information
CYCLO (ARG-GLY-ASP-D-PHE-LYS) Usage And Synthesis
| Uses | Cyclo (-RGDfK) Trifluoroacetic Acid Salt is a potent inhibitor of αvβ3 integrin. Used in tumor therapy due to the targeting of the VEGFR2 gene by sRNA. |
| Biological Activity | in one study where this peptide was labeled with 125i, it was found to bind specifically and with high affinity to αvβ3 receptors on neovascular blood vessel sections of different major human cancers. the integrin alpha(iib)beta(3)-specific cyclic hexapeptide contains an arg-gly-asp (rgd) sequence. |
| target | Integrin |
| IC 50 | αvβ3: 0.94 nM (IC50) |
CYCLO (ARG-GLY-ASP-D-PHE-LYS) Preparation Products And Raw materials
| Raw materials | Fmoc-Lys(Trt)-OH-->Fmoc-N'-Acetyl-L-lysine-->Fmoc-Asp(OtBu)-OH |