Introduction：Basic information about Dehydroandrographolide CAS 134418-28-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Dehydroandrographolide Basic information
| Product Name: | Dehydroandrographolide |
| Synonyms: | ANDROGRAPHOLIDE, DEHYDRO-;DEHYDROANDROGRAPHOLIDE;14-Deoxy-11-dehydroandrographolide;Dehydroandrographoline;14-(P);DEOXY-11,12-DIDEHYDROANDROGRAPHOLIDE;(3E)-3-[2-[(1S,4aS,5R,6R,8aS)-Decahydro-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylene-1-naphthalenyl]ethylidene]-2(3H)-furanone;2(3H)-Furanone,3-[2-[(1S,4aS,5R,6R,8aS)-decahydro- |
| CAS: | 134418-28-3 |
| MF: | C20H28O4 |
| MW: | 332.43 |
| EINECS: | |
| Product Categories: | Inhibitors;chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract |
| Mol File: | 134418-28-3.mol |
|
Dehydroandrographolide Chemical Properties
| Melting point | 205-208oC |
| Boiling point | 508.0±45.0 °C(Predicted) |
| density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | 4°C, protect from light |
| solubility | Acetic Acid (Very Slightly), DMSO (Slightly), Ethanol (Very Slightly) |
| form | Solid |
| pka | 14.84±0.70(Predicted) |
| color | White |
| biological source | plant (Andrographis paniculata) |
| Major Application | metabolomics
vitamins, nutraceuticals, and natural products |
| InChIKey | YIIRVUDGRKEWBV-GJVBFGQCSA-N |
| SMILES | OC[C@@]([C@H](O)CC1)(C)C([C@]1(C)[C@H]2C/C=C3C=COC\3=O)CCC2=C |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
Dehydroandrographolide Usage And Synthesis
| Chemical Properties | White crystalline powder, easily soluble in ethanol, acetone, soluble in chloroform, slightly soluble in benzene, almost insoluble in water, from Andrographis paniculata whole plant. |
| Uses | Dehydroandrographolide is a natural diterpenoid with activity against HBV (hepatitis B) DNA replication. Hepatoprotective agent. |
| Biological Activity | Dehydroandrographolide possesses activity against hepatitis B virus DNA replication. |
Dehydroandrographolide Preparation Products And Raw materials
