Introduction：Basic information about Octaethylene Glycol Monomethyl Ether CAS 25990-96-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Octaethylene Glycol Monomethyl Ether Basic information
| Product Name: | Octaethylene Glycol Monomethyl Ether |
| Synonyms: | 2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;OCTAETHYLENE GLYCOL MONOMETHYL EHTER;MPEG8-OH;MPEG-8;Octaethylene Glycol MonoMethyl Ethe;2,5,8,11,14,17,20,23-octaoxapentacosan-25-ol;OCTAETHYLENE GLYCOL MONOMETHYL ETHER;3,6,9,12,15,18,21,24-Octaoxapentacosan-1-ol |
| CAS: | 25990-96-9 |
| MF: | C17H36O9 |
| MW: | 384.46 |
| EINECS: | |
| Product Categories: | Ethylene Glycols & Monofunctional Ethylene Glycols;Monofunctional Ethylene Glycols;peg |
| Mol File: | 25990-96-9.mol |
|
Octaethylene Glycol Monomethyl Ether Chemical Properties
| Boiling point | 216 °C / 2mmHg |
| density | 1.09 |
| refractive index | 1.4560 to 1.4600 |
| storage temp. | 2-8°C |
| form | clear liquid |
| pka | 14.36±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C17H36O9/c1-19-4-5-21-8-9-23-12-13-25-16-17-26-15-14-24-11-10-22-7-6-20-3-2-18/h18H,2-17H2,1H3 |
| InChIKey | SZGNWRSFHADOMY-UHFFFAOYSA-N |
| SMILES | C(O)COCCOCCOCCOCCOCCOCCOCCOC |
Safety Information
Octaethylene Glycol Monomethyl Ether Usage And Synthesis
| Description | m-PEG8-alcohol is a PEG linker containing a hydroxyl group. The hydroxyl group enables further derivatization or replacement with other reactive functional groups. The hydrophilic PEG spacer increases solubility in aqueous media. |
| Uses | Octaethylene glycol monomethyl ether is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. |
| IC 50 | PEGs |
Octaethylene Glycol Monomethyl Ether Preparation Products And Raw materials
| Preparation Products | 3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine-->Dodecaethylene glycol monomethyl ether-->mPEG8-Alkyne |
