Introduction：Basic information about PINORESINOL CAS 4263-88-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
PINORESINOL Basic information
| Product Name: | PINORESINOL |
| Synonyms: | PINORESINOL;PINORESINOL DIGLUCOPYRANOSIDE;Phenol, 4,4'-[(1R,3aS,4R,6aS)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl]bis[2-methoxy-, rel-;DL-Pinoresinol;(±)-Pinoresinol |
| CAS: | 4263-88-1 |
| MF: | C20H22O6 |
| MW: | 358.39 |
| EINECS: | |
| Product Categories: | |
| Mol File: | Mol File |
|
PINORESINOL Chemical Properties
| Melting point | 144-145℃ |
| Boiling point | 556.5±50.0 °C(Predicted) |
| density | 1.287±0.06 g/cm3(Predicted) |
| pka | 9.54±0.35(Predicted) |
| InChI | InChI=1/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14-,19+,20+/s3 |
| InChIKey | HGXBRUKMWQGOIE-VVZREXRKNA-N |
| SMILES | O1C[C@@]2([H])[C@H](C3=CC=C(O)C(OC)=C3)OC[C@@]2([H])[C@@H]1C1=CC=C(O)C(OC)=C1 |&1:2,4,16,18,r| |
Safety Information
PINORESINOL Usage And Synthesis
| Uses | (±)-Pinoresinol is a potent antifungal agent. (±)-Pinoresinol shows antifungal activity[1]. |
| References | [1] Kim SY, et al. Effect of Pinoresinol and Vanillic Acid Isolated from Catalpa bignonioides on Mouse Myoblast Proliferation via the Akt/mTOR Signaling Pathway. Molecules. 2022 Aug 24;27(17):5397. DOI:10.3390/molecules27175397 |
PINORESINOL Preparation Products And Raw materials
