Introduction：Basic information about 4,4'-Diacetylbiphenyl CAS 787-69-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4,4'-Diacetylbiphenyl Basic information
| Product Name: | 4,4'-Diacetylbiphenyl |
| Synonyms: | 4',4''-BIACETOPHENONE;1-(4'-Acetyl[1,1'-biphenyl]-4-yl)ethanone;4,4'-Diacetylbiphenyl,98%;4,4'-Diacetylbiphenyl 98%;4,4'-Diacetylbiphenyl ,99%;1,1'-(Biphenyl-4,4'-diyl)bis(ethanone);4'-(4-Acetylphenyl)acetophenone;4,4'-Diacetyl-1,1'-biphenyl |
| CAS: | 787-69-9 |
| MF: | C16H14O2 |
| MW: | 238.28 |
| EINECS: | 625-368-5 |
| Product Categories: | APIS;C15 to C38;Aromatic Acetophenones & Derivatives (substituted);Biphenyl & Diphenyl ether;Carbonyl Compounds;Ketones;Biphenyls (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;1 |
| Mol File: | 787-69-9.mol |
|
4,4'-Diacetylbiphenyl Chemical Properties
| Melting point | 193-195 °C(lit.) |
| Boiling point | 340.88°C (rough estimate) |
| density | 1.0981 (rough estimate) |
| refractive index | 1.6290 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform |
| form | Crystalline Powder |
| color | Colorless to light tan |
| InChI | InChI=1S/C16H14O2/c1-11(17)13-3-7-15(8-4-13)16-9-5-14(6-10-16)12(2)18/h3-10H,1-2H3 |
| InChIKey | YSTSBXDVNKYPTR-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C(=O)C)C=C2)=CC=C(C(=O)C)C=C1 |
| CAS DataBase Reference | 787-69-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,4'-Diacetyl biphenyl(787-69-9) |
Safety Information
| Hazard Codes | N,Xi,Xn |
| Risk Statements | 50/53-36/37/38-20/21/22 |
| Safety Statements | 60-61-36/37/39-26-37/39-36 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29173990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 |
4,4'-Diacetylbiphenyl Usage And Synthesis
| Chemical Properties | White solid |
| Uses | Intermediates of Liquid Crystals |
| Synthesis Reference(s) | Journal of the American Chemical Society, 93, p. 5908, 1971 DOI: 10.1021/ja00751a062
The Journal of Organic Chemistry, 51, p. 2627, 1986 DOI: 10.1021/jo00364a002 |
| General Description | The keto oxime and glyoxime derivatives of 4,4′-diacetylbiphenyl were synthesized and characterized by NMR and Fourier transform infrared spectroscopy techniques. |
4,4'-Diacetylbiphenyl Preparation Products And Raw materials
| Raw materials | Aluminum chloride-->Acetyl chloride-->Carbon disulfide-->Biphenyl |
| Preparation Products | 4,4'-DIETHYNYLBIPHENYL-->4,4'-Divinylbiphenyl-->2,4,6-Trimethyliodobenzene-->4,4'-DIGLYOXYLOYLBIPHENYL |
