Introduction：Basic information about 4,4'-DICHLOROBIPHENYL CAS 2050-68-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4,4'-DICHLOROBIPHENYL Basic information
| Product Name: | 4,4'-DICHLOROBIPHENYL |
| Synonyms: | 4,4'-DICHLOROBIPHENYL;4,4'-PCB;PCB NO 15;4,4μ-Dichlorobiphenyl, 4,4μ-PCB;1,1’-biphenyl,4,4’-dichloro-;4,4’-dichloro-1,1’-biphenyl;4,4’-dichloro-1’-biphenyl;4,4’-dichloro-bipheny |
| CAS: | 2050-68-2 |
| MF: | C12H8Cl2 |
| MW: | 223.1 |
| EINECS: | 218-095-4 |
| Product Categories: | Method 508Environmental Standards;500 Series Drinking Water Methods;Aroclors, PCBs, and Dioxins;EPA;PCBs |
| Mol File: | 2050-68-2.mol |
|
4,4'-DICHLOROBIPHENYL Chemical Properties
| Melting point | 288℃ |
| Boiling point | 289.78°C (rough estimate) |
| density | 1.2490 (rough estimate) |
| refractive index | 1.5940 (rough estimate) |
| Fp | -12℃ |
| storage temp. | 2-8°C |
| Water Solubility | 53ug/L(25 ºC) |
| InChI | InChI=1S/C12H8Cl2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H |
| InChIKey | YTBRNEUEFCNVHC-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(Cl)C=C2)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 2050-68-2(CAS DataBase Reference) |
| EPA Substance Registry System | 4,4'-Dichlorobiphenyl (2050-68-2) |
Safety Information
| Hazard Codes | F,Xi,Xn,N |
| Risk Statements | 11-36/37/38-22-50/53-33-67-65-38 |
| Safety Statements | 16-26-33-36-61-60-35-62 |
| RIDADR | 2315 |
| WGK Germany | 3 |
| RTECS | DV3912500 |
| HazardClass | 9 |
| PackingGroup | II |
4,4'-DICHLOROBIPHENYL Usage And Synthesis
| Uses | 4,4''-Dichlorobiphenyl is a polychlorinated biphenyl (PCB) congeners. |
| Definition | ChEBI: A dichlorobiphenyl carrying chloro groups at positions 4 and 4' respectively. |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 54, p. 4840, 1989 DOI: 10.1021/jo00281a027
Tetrahedron, 39, p. 2381, 1983 DOI: 10.1016/S0040-4020(01)91964-7 |
4,4'-DICHLOROBIPHENYL Preparation Products And Raw materials
| Preparation Products | 2,4'-DICHLOROBIPHENYL |
