Introduction：Basic information about 4,4'-Diiodobiphenyl CAS 3001-15-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4,4'-Diiodobiphenyl Basic information
| Product Name: | 4,4'-Diiodobiphenyl |
| Synonyms: | 4-(4'-IODOPHENYL)IODOBENZENE;4,4'-DIODOBIPHENYL;4,4'-Diiodobiphenyl (DIB);4,4''-DIIODOBIPHENYL 98%;4,4-DIIODOBIPHENYL 99.5%;1,1'-Biphenyl, 4,4'-diiodo-;4,4’-diiodo-1’-biphenyl;Biphenyl, 4,4'-diiodo |
| CAS: | 3001-15-8 |
| MF: | C12H8I2 |
| MW: | 406 |
| EINECS: | 221-080-5 |
| Product Categories: | Biphenyl derivatives;pharmacetical;Liquid Crystal intermediates;Miscellaneous;Biphenyls (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;White to light yellow crystalline powder;Aryl;C9 to C12;Halogenated Hydrocarbons;Pyridines |
| Mol File: | 3001-15-8.mol |
|
4,4'-Diiodobiphenyl Chemical Properties
| Melting point | 201-204 °C(lit.) |
| Boiling point | 380.9±35.0 °C(Predicted) |
| density | 2.041±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in hot Toluene(very faint turbidity). |
| form | Powder |
| color | Pale yellow to beige |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C12H8I2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H |
| InChIKey | GPYDMVZCPRONLW-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(I)C=C2)=CC=C(I)C=C1 |
| CAS DataBase Reference | 3001-15-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,4'-Diiododiphenyl(3001-15-8) |
| EPA Substance Registry System | 1,1'-Biphenyl, 4,4'-diiodo- (3001-15-8) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-37/38-36-36/37/38 |
| Safety Statements | 36-37-26 |
| RIDADR | UN 3152 9/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
4,4'-Diiodobiphenyl Usage And Synthesis
| Chemical Properties | Crystalline powder |
| Uses | suzuki reaction |
| Uses | 4,4?-diiodobiphenyl was coupled with (trimethylsilyl) acetylene via a Sonogashira-Hagihara reaction to afford the (trimethylsilyl)ethynyl derivative. 4,4?-diiodobipheny enhanced the expression of the luciferase gene. |
| Uses | Intermediates of Liquid Crystals |
4,4'-Diiodobiphenyl Preparation Products And Raw materials
| Raw materials | Benzene, 1-iodo-4-(trimethylsilyl)--->3,3'-BIANISOLE-->4-Iodobenzenesulfonohydrazide-->2-(3-methoxyphenyl)-5, 5-dimethyl-1,3,2-dioxaborinane-->3-Methoxyphenylboronic Acid Pinacol Ester |
| Preparation Products | N,N,N',N'-Tetraphenylbenzidine-->4-Iodobiphenyl-->1,4-Benzenedipropanal-->1-Chloro-4-iodobenzene-->PYRIDINE, 4,4'-[1,1'-BIPHENYL]-4,4'-DIYLBIS--->Biphenyl-4,4'-dithiol-->4,4'-DIETHYNYLBIPHENYL-->N,N'-Di-(4-methyl-phenyl)-benzidine |
