Introduction:Basic information about 4,4'-DIHYDROXY-2-METHOXYCHALCONE CAS 34221-41-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4,4'-DIHYDROXY-2-METHOXYCHALCONE Basic information
| Product Name: | 4,4'-DIHYDROXY-2-METHOXYCHALCONE |
| Synonyms: | (E)-3-(4-hydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one;ECHINATIN;(E)-3-(4-Hydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)-2-propen-1-one;(E)-4,4'-Dihydroxy-2-methoxychalcone;4,4'-Dihydroxy-2-methoxy-trans-chalcone;ECHINATIN(RG)(CALL);4'-Dihydroxy-2-Methoxychalcone;Retrochalcone |
| CAS: | 34221-41-5 |
| MF: | C16H14O4 |
| MW: | 270.28 |
| EINECS: | |
| Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;sy;Chalcones |
| Mol File: | 34221-41-5.mol |
|
4,4'-DIHYDROXY-2-METHOXYCHALCONE Chemical Properties
| Melting point | 210°C (dec.) |
| Boiling point | 509.8±50.0 °C(Predicted) |
| density | 1.282±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | DMSO : 250 mg/mL (924.97 mM; Need ultrasonic) |
| form | powder |
| pka | 7.82±0.15(Predicted) |
| color | Orange |
| Major Application | food and beverages |
| InChI | InChI=1S/C16H14O4/c1-20-16-10-14(18)8-4-12(16)5-9-15(19)11-2-6-13(17)7-3-11/h2-10,17-18H,1H3/b9-5+ |
| InChIKey | QJKMIJNRNRLQSS-WEVVVXLNSA-N |
| SMILES | C(C1=CC=C(O)C=C1)(=O)/C=C/C1=CC=C(O)C=C1OC |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
4,4'-DIHYDROXY-2-METHOXYCHALCONE Usage And Synthesis
| Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from licorice root. |
| Uses | Echinatin is used as an anticancer agent inhibiting DNA topoisomerase IB and Tyrosyl-DNA phosphodiesterase 1 inhibitors. |
| in vivo | Echinatin (20 and 40 mg/kg, i.p.) inhibits LPS-induced septic shock in mice by inhibiting NLRP3 inflammasome activation[2]. Echinatin (20-80 mg/kg, i.p.) shows cardioprotective effect, and relieves I/R-Induced Myocardial Injury in rats[3]. Echinatin (20 and 50?mg/kg, p.o.) inhibits tumor growth and inhibits the AKT/mTOR pathway of KYSE270-derived tumor mice xenografts[4].
| Animal Model: | LPS-induced septic shock in mice[1] | | Dosage: | 20 and 40 mg/kg | | Administration: | i.p. | | Result: | Inhibited LPS-induced IL-1β and TNF-α production. Reduced the proportion and the number of neutrophils in peritoneal lavage cells from mice. |
|
4,4'-DIHYDROXY-2-METHOXYCHALCONE Preparation Products And Raw materials